Loading distributor info...
| Description | Relugolix is a novel, non-peptide, orally active gonadotropin-releasing hormone (GnRH) antagonist with IC50 of 0.33 nM in the presence of 40% fetal bovine serum, TAK-385 possesses higher affinity and potent antagonistic activity compared with TAK-013. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17783 |
|---|---|
| Formula | C29H27F2N7O5S |
| Molecular Weight | 623.63 |
| CAS Number | 737789-87-6 |
| SMILES | O=C(NOC)NC1=CC=C(C(S2)=C(CN(C)C)C(C(N3C4=NN=C(OC)C=C4)=O)=C2N(CC5=C(F)C=CC=C5F)C3=O)C=C1 |
| Synonyms | TAK385; TAK-385; TAK 385; Relugolix. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (94.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.04 mL | 80.18 mL | 160.35 mL |
| 0.5 mM | 3.21 mL | 16.04 mL | 32.07 mL |
| 1 mM | 1.6 mL | 8.02 mL | 16.04 mL |
| 5 mM | 0.32 mL | 1.6 mL | 3.21 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
