Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ro 3306 is an ATP-competitive, potent cyclin-dependent kinase (cdk) 1 inhibitor (Ki values are 35 and 110 nM for cdk1/cyclin B1 and cdk1/cyclin A respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14437 |
|---|---|
| Formula | C18H13N3OS2 |
| Molecular Weight | 351.45 |
| CAS Number | 872573-93-8 |
| SMILES | C1=CC2=C(C=CC(=C2)/C=C/3\C(=O)N=C(S3)NCC4=CC=CS4)N=C1 |
| Synonyms | Ro3306, Ro-3306 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 12 mg/mL (34.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.45 mL | 142.27 mL | 284.54 mL |
| 0.5 mM | 5.69 mL | 28.45 mL | 56.91 mL |
| 1 mM | 2.85 mL | 14.23 mL | 28.45 mL |
| 5 mM | 0.57 mL | 2.85 mL | 5.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
