Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rosiglitazone maleate, an antidiabetic drug, works as an insulin sensitizer, by binding to the PPAR receptors in fat cells and making the cells more responsive to insulin. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10809 |
|---|---|
| Formula | C22H23N3O7S |
| Molecular Weight | 473.5 |
| CAS Number | 155141-29-0 |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3.C(=C\C(=O)O)\C(=O)O |
| Synonyms | Avandia, Avandamet, Avandaryl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (187.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.12 mL | 105.6 mL | 211.19 mL |
| 0.5 mM | 4.22 mL | 21.12 mL | 42.24 mL |
| 1 mM | 2.11 mL | 10.56 mL | 21.12 mL |
| 5 mM | 0.42 mL | 2.11 mL | 4.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
