Loading distributor info...
| Description | Roxatidine Acetate Hydrochloride is a histamine H2-receptor antagonist used in ulcer treatment. This compound has been found to inhibit platelet function in vitro. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11921 |
|---|---|
| Formula | C19H29ClN2O4 |
| Molecular Weight | 384.9 |
| CAS Number | 93793-83-0 |
| SMILES | CC(=O)OCC(=O)NCCCOC1=CC=CC(=C1)CN2CCCCC2.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (174.07 mM) | |
| Water | 67 mg/mL (174.07 mM) | ||
| Ethanol | 10 mg/mL (25.98 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.98 mL | 129.9 mL | 259.81 mL |
| 0.5 mM | 5.2 mL | 25.98 mL | 51.96 mL |
| 1 mM | 2.6 mL | 12.99 mL | 25.98 mL |
| 5 mM | 0.52 mL | 2.6 mL | 5.2 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
