Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RSV604 is a novel inhibitor of respiratory syncytial virus replication(EC50=0.86 uM); a putative RSV nucleoprotein(N) inhibitor in phase 2 clinical trials. |
|---|
| Catalog Num | A21355 |
|---|---|
| Formula | C22H17FN4O2 |
| Molecular Weight | 388.39 |
| CAS Number | 676128-63-5 |
| SMILES | O=C1[C@@H](NC(NC2=C(F)C=CC=C2)=O)N=C(C3=CC=CC=C3)C4=CC=CC=C4N1 |
| Synonyms | RSV 604, RSV-604 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (190.52 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 9 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.75 mL | 128.74 mL | 257.47 mL |
| 0.5 mM | 5.15 mL | 25.75 mL | 51.49 mL |
| 1 mM | 2.57 mL | 12.87 mL | 25.75 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
