Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RTA-408 is a synthetic triterpenoid that potently activates the antioxidative transcription factor Nrf2 and inhibits the proinflammatory transcription factor NF-kB. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14417 |
|---|---|
| Formula | C33H44F2N2O3 |
| Molecular Weight | 554.71 |
| CAS Number | 1474034-05-3 |
| SMILES | C[C@@]12CC[C@]3(CCC(C[C@H]3[C@H]1C(=O)C=C4[C@]2(CC[C@@H]5[C@@]4(C=C(C(=O)C5(C)C)C#N)C)C)(C)C)NC(=O)C(C)(F)F |
| Synonyms | RTA 408, RTA408 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 98 mg/mL (176.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 20 mg/mL (36.05 mM) | ||
| In vivo | 10%DMSO+90% Corn oil | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.03 mL | 90.14 mL | 180.27 mL |
| 0.5 mM | 3.61 mL | 18.03 mL | 36.05 mL |
| 1 mM | 1.8 mL | 9.01 mL | 18.03 mL |
| 5 mM | 0.36 mL | 1.8 mL | 3.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
