RU 58841
Catalog No.: A11541
AR antagonist
RU58841, also known as PSK-3841 or HMR-3841, is a non-steroidal anti-androgen.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | RU58841, also known as PSK-3841 or HMR-3841, is a non-steroidal anti-androgen. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11541 |
|---|---|
| Formula | C17H18F3N3O3 |
| Molecular Weight | 369.3 |
| CAS Number | 154992-24-2 |
| SMILES | CC1(C(=O)N(C(=O)N1CCCCO)C2=CC(=C(C=C2)C#N)C(F)(F)F)C |
| Synonyms | RU58841, RU-58841, Benzonitrile |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 64 mg/mL (173.27 mM) | |
| Water | Insoluble | ||
| Ethanol | 64 mg/mL (173.27 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.08 mL | 135.39 mL | 270.78 mL |
| 0.5 mM | 5.42 mL | 27.08 mL | 54.16 mL |
| 1 mM | 2.71 mL | 13.54 mL | 27.08 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.42 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2