Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Rupatadine is an inhibitor of PAFR and histamine (H1) receptor with Ki of 550 and 102 nM, respectively. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11222 |
|---|---|
| Formula | C26H26ClN3 |
| Molecular Weight | 415.96 |
| CAS Number | 158876-82-5 |
| SMILES | CC1=CC(=CN=C1)CN2CCC(=C3C4=C(CCC5=C3N=CC=C5)C=C(C=C4)Cl)CC2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (15.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 12 mg/mL (22.55 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.04 mL | 120.2 mL | 240.41 mL |
| 0.5 mM | 4.81 mL | 24.04 mL | 48.08 mL |
| 1 mM | 2.4 mL | 12.02 mL | 24.04 mL |
| 5 mM | 0.48 mL | 2.4 mL | 4.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
