Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | (S,R,S)-AHPC-PEG4-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the (S,R,S)-AHPC based VHL ligand and 4-unit PEG linker used in PROTAC technology. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20180 |
|---|---|
| Formula | C32H50ClN5O8S |
| Molecular Weight | 700.29 |
| CAS Number | 2064292-52-8 |
| SMILES | O=C(N[C@@H](C(C)(C)C)C(N(C[C@H](O)C1)[C@@H]1C(NCC2=CC=C(C(SC=N3)=C3C)C=C2)=O)=O)COCCOCCOCCOCCN.Cl |
| Synonyms | VH032-PEG4-NH2 hydrochloride; VHL Ligand-Linker Conjugates 4 hydrochloride; E3 ligase Ligand-Linker Conjugates 7 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (139.93 mM) | |
| Water | 98 mg/mL (139.93 mM) | ||
| Ethanol | 98 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.28 mL | 71.4 mL | 142.8 mL |
| 0.5 mM | 2.86 mL | 14.28 mL | 28.56 mL |
| 1 mM | 1.43 mL | 7.14 mL | 14.28 mL |
| 5 mM | 0.29 mL | 1.43 mL | 2.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
