Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | S1RA is a selective sigma-1 receptor antagonist, with a reported binding affinity of Ki = 17.0 ?? 7.0 nM, selective over the sigma-2 receptor and against a panel of other 170 receptors, enzymes, transporters and ion channels. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12504 |
|---|---|
| Formula | C20H23N3O2 |
| Molecular Weight | 337.42 |
| CAS Number | 878141-96-9 |
| SMILES | CC1=CC(=NN1C2=CC3=CC=CC=C3C=C2)OCCN4CCOCC4 |
| Synonyms | E52862, E 52862, MR390; MR 390; MR-390 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (186.71 mM) | |
| Water | 63 mg/mL (186.71 mM) | ||
| Ethanol | 18 mg/mL (53.34 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.64 mL | 148.18 mL | 296.37 mL |
| 0.5 mM | 5.93 mL | 29.64 mL | 59.27 mL |
| 1 mM | 2.96 mL | 14.82 mL | 29.64 mL |
| 5 mM | 0.59 mL | 2.96 mL | 5.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
