SB269970
Catalog No.: A11925
5-HT7 receptor antagonist
SB269970 is a potent and selective 5-HT7 receptor antagonist.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | SB269970 is a potent and selective 5-HT7 receptor antagonist. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11925 |
|---|---|
| Formula | C18H28N2O3S |
| Molecular Weight | 352.5 |
| CAS Number | 201038-74-6 |
| SMILES | CC1CCN(CC1)CC[C@H]2CCCN2S(=O)(=O)C3=CC=CC(=C3)O |
| Synonyms | SB-269970,SB 269770 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 10 mg/mL (25.71 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.37 mL | 141.84 mL | 283.69 mL |
| 0.5 mM | 5.67 mL | 28.37 mL | 56.74 mL |
| 1 mM | 2.84 mL | 14.18 mL | 28.37 mL |
| 5 mM | 0.57 mL | 2.84 mL | 5.67 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2