Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Schizandrin A is an antioxidant agent. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14531 |
|---|---|
| Formula | C24H32O6 |
| Molecular Weight | 416.51 |
| CAS Number | 61281-38-7 |
| SMILES | CC1CC2=CC(=C(C(=C2C3=C(C(=C(C=C3CC1C)OC)OC)OC)OC)OC)OC |
| Synonyms | Deoxyschizandrin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (184.86 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.01 mL | 120.05 mL | 240.09 mL |
| 0.5 mM | 4.8 mL | 24.01 mL | 48.02 mL |
| 1 mM | 2.4 mL | 12 mL | 24.01 mL |
| 5 mM | 0.48 mL | 2.4 mL | 4.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
