Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SOS1-IN-2 is a Son of Sevenless 1 (SOS1) inhibitor with an IC50 of 6 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18507 |
|---|---|
| Formula | C23H25F3N4O3 |
| Molecular Weight | 462.46 |
| CAS Number | 2230836-55-0 |
| SMILES | CC1=NC(N[C@@H](C2=CC(C(F)(F)F)=CC(N)=C2)C)=C3C=C(O[C@@H]4COCC4)C(OC)=CC3=N1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (183.79 mM) | |
| Water | Insoluble | ||
| Ethanol | 85 mg/mL (183.79 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.62 mL | 108.12 mL | 216.23 mL |
| 0.5 mM | 4.32 mL | 21.62 mL | 43.25 mL |
| 1 mM | 2.16 mL | 10.81 mL | 21.62 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
