Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sulfamonmethoxine is a competitive inhibitor of dihydropteroate synthetase, blocking the synthesis of folic acid. |
|---|
| Catalog Num | A17267 |
|---|---|
| Formula | C11H12N4O3S |
| Molecular Weight | 280.302 |
| CAS Number | 1220-83-3 |
| SMILES | O=S(C1=CC=C(N)C=C1)(NC2=NC=NC(OC)=C2)=O |
| Synonyms | Sulfamonmethoxine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (196.21 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (14.27 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.68 mL | 178.38 mL | 356.76 mL |
| 0.5 mM | 7.14 mL | 35.68 mL | 71.35 mL |
| 1 mM | 3.57 mL | 17.84 mL | 35.68 mL |
| 5 mM | 0.71 mL | 3.57 mL | 7.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
