Loading distributor info...
| Description | Sulfaphenazole is a specific inhibitor of CYP2C9 which blocks atherogenic and pro-inflammatory effects of linoleic acid (increase in oxidative stress and activation of AP-1) mediated by CYP2C9. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17283 |
|---|---|
| Formula | C15H14N4O2S |
| Molecular Weight | 314.363 |
| CAS Number | 526-08-9 |
| SMILES | O=S(NC1=CC=NN1C2=CC=CC=C2)(C3=CC=C(N)C=C3)=O |
| Synonyms | BRN-0308518; BRN0308518; BRN 0308518; Sulfaphenazole; Firmazolo; Inamil |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (168.59 mM) | |
| Water | Insoluble | ||
| Ethanol | 53 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.81 mL | 159.05 mL | 318.1 mL |
| 0.5 mM | 6.36 mL | 31.81 mL | 63.62 mL |
| 1 mM | 3.18 mL | 15.91 mL | 31.81 mL |
| 5 mM | 0.64 mL | 3.18 mL | 6.36 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
