Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TAE684 is a inhibitor of ALK and also a potent inhibitor of LRRK2 kinase activity (IC(50) of 7.8nM against wild-type LRRK2, 6.1nM against the G2019S mutant). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10662 |
|---|---|
| Formula | C30H40ClN7O3S |
| Molecular Weight | 614.2 |
| CAS Number | 761439-42-3 |
| SMILES | CC(C)S(=O)(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)NC3=C(C=C(C=C3)N4CCC(CC4)N5CCN(CC5)C)OC |
| Synonyms | NVP-TAE684 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 3 mg/mL (4.88 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol, pH 4 | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.28 mL | 81.41 mL | 162.81 mL |
| 0.5 mM | 3.26 mL | 16.28 mL | 32.56 mL |
| 1 mM | 1.63 mL | 8.14 mL | 16.28 mL |
| 5 mM | 0.33 mL | 1.63 mL | 3.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
