Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Talabostat mesylate is a potent, nonselective and orally available dipeptidyl peptidase IV (DPP-IV) inhibitor with a Ki of 0.18 nM. |
|---|
| Catalog Num | A14080 |
|---|---|
| Formula | C10H23BN2O6S |
| Molecular Weight | 310.18 |
| CAS Number | 150080-09-4 |
| SMILES | CC(C)[C@H](N)C(N1[C@H](B(O)O)CCC1)=O.CS(=O)(O)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (177.31 mM) | |
| Water | 55 mg/mL (177.31 mM) | ||
| Ethanol | 55 mg/mL (177.31 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.24 mL | 161.2 mL | 322.39 mL |
| 0.5 mM | 6.45 mL | 32.24 mL | 64.48 mL |
| 1 mM | 3.22 mL | 16.12 mL | 32.24 mL |
| 5 mM | 0.64 mL | 3.22 mL | 6.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
