Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TAME hydrochloride is an inhibitor of anaphase-promoting complex/cyclosome (APC/C or APC), which binds to APC/C and prevents its activation by Cdc20 and Cdh1, produces mitotic arrest. |
|---|
| Catalog Num | A21960 |
|---|---|
| Formula | C14H23ClN4O4S |
| Molecular Weight | 378.87 |
| CAS Number | 1784-03-8 |
| SMILES | CC1=CC=C(C=C1)S(N[C@H](C(OC)=O)CCCNC(N)=N)(=O)=O.[H]Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (175.53 mM) | |
| Water | 81 mg/mL (175.53 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.39 mL | 131.97 mL | 263.94 mL |
| 0.5 mM | 5.28 mL | 26.39 mL | 52.79 mL |
| 1 mM | 2.64 mL | 13.2 mL | 26.39 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
