Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tanshinone IIA sulfonic sodium is a water-soluble derivative of tanshinone IIA isolated as the major active component from salvia miltiorrhiza, a kind of Chinese herbal medicine. |
|---|
| Catalog Num | A14595 |
|---|---|
| Formula | C19H17O6SNa |
| Molecular Weight | 396.39 |
| CAS Number | 69659-80-9 |
| SMILES | CC1=C(OC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C)S(=O)(=O)[O-].[Na+] |
| Synonyms | Sulfotanshinone sodium II-A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (189.2 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.23 mL | 126.14 mL | 252.28 mL |
| 0.5 mM | 5.05 mL | 25.23 mL | 50.46 mL |
| 1 mM | 2.52 mL | 12.61 mL | 25.23 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.05 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
