Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TAS0728 is a potent, selective, oral active, irreversible and covalent-binding HER2 inhibitor, binds to HER2 at C805, inhibits its kinase activity, with an IC50 of 13 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19382 |
|---|---|
| Formula | C26H32N8O3 |
| Molecular Weight | 504.58 |
| CAS Number | 2088323-16-2 |
| SMILES | NC1=C2C(N([C@H]3CN(C(C=C)=O)CCC3)N=C2C(NC4=CC=C(CC(N(C)C)=O)C(C)=C4C)=O)=NC=N1 |
| Synonyms | TAS 0728, TAS-0728 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (182.33 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.82 mL | 99.09 mL | 198.18 mL |
| 0.5 mM | 3.96 mL | 19.82 mL | 39.64 mL |
| 1 mM | 1.98 mL | 9.91 mL | 19.82 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
