Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TAS6417 is an EGFR inhibitor and an efficacious drug candidate for patients with NSCLC, with IC50 values ranging from 1.1-8.0 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19541 |
|---|---|
| Formula | C23H20N6O |
| Molecular Weight | 396.44 |
| CAS Number | 1661854-97-2 |
| SMILES | NC1=C2C(N3C(C(C)=C[C@@H](C3)NC(C=C)=O)=C2C4=CC5=CC=CC=C5N=C4)=NC=N1 |
| Synonyms | TAS 6417, TAS-6417 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (179.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 71 mg/mL (179.09 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.22 mL | 126.12 mL | 252.24 mL |
| 0.5 mM | 5.04 mL | 25.22 mL | 50.45 mL |
| 1 mM | 2.52 mL | 12.61 mL | 25.22 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
