Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TCS ERK 11e (VX-11e) is a potent and selective extracellular signal-related kinase 2 (ERK2) inhibitor (Ki values are <2, 395, 540 and 852 nM for ERK2, GSK-3, Aurora Kinase A and Cdk2 respectively). Potently blocks proliferation of HT29 cells (IC50 = 48 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12505 |
|---|---|
| Formula | C24H20Cl2FN5O2 |
| Molecular Weight | 500.35 |
| CAS Number | 896720-20-0 |
| SMILES | CC1=CN=C(N=C1C2=CNC(=C2)C(=O)N[C@H](CO)C3=CC(=CC=C3)Cl)NC4=C(C=C(C=C4)F)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (187.87 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (29.97 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.99 mL | 99.93 mL | 199.86 mL |
| 0.5 mM | 4 mL | 19.99 mL | 39.97 mL |
| 1 mM | 2 mL | 9.99 mL | 19.99 mL |
| 5 mM | 0.4 mL | 2 mL | 4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
