Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tedizolid (TR-701) is a novel oxazolidinone antibacterial agent. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11591 |
|---|---|
| Formula | C17H15FN6O3 |
| Molecular Weight | 370.34 |
| CAS Number | 856866-72-3 |
| SMILES | CN1N=C(N=N1)C2=NC=C(C=C2)C3=C(C=C(C=C3)N4C[C@@H](OC4=O)CO)F |
| Synonyms | Torezolid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (24.3 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27 mL | 135.01 mL | 270.02 mL |
| 0.5 mM | 5.4 mL | 27 mL | 54 mL |
| 1 mM | 2.7 mL | 13.5 mL | 27 mL |
| 5 mM | 0.54 mL | 2.7 mL | 5.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
