Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | THZ531 is a covalent CDK12 and CDK13 covalent inhibitor. THZ531 irreversibly targets a cysteine located outside the kinase domain. THZ531 causes a loss of gene expression with concurrent loss of elongating and hyperphosphorylated RNA polymerase II. |
|---|
| Catalog Num | A17036 |
|---|---|
| Formula | C30H32ClN7O2 |
| Molecular Weight | 558.08 |
| CAS Number | 1702809-17-3 |
| SMILES | O=C(NC1=CC=C(C(N2C[C@H](NC3=NC=C(Cl)C(C4=CNC5=C4C=CC=C5)=N3)CCC2)=O)C=C1)/C=C/CN(C)C |
| Synonyms | THZ-531, THZ 531 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (170.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 95 mg/mL (170.22 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.92 mL | 89.59 mL | 179.19 mL |
| 0.5 mM | 3.58 mL | 17.92 mL | 35.84 mL |
| 1 mM | 1.79 mL | 8.96 mL | 17.92 mL |
| 5 mM | 0.36 mL | 1.79 mL | 3.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
