Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ticagrelor (AZD6140) is the first reversibly binding oral P2Y(12) receptor antagonist that blocks ADP-induced platelet aggregation. |
|---|
| Catalog Num | A11238 |
|---|---|
| Formula | C23H28F2N6O4S |
| Molecular Weight | 522.6 |
| CAS Number | 274693-27-5 |
| SMILES | CCCSC1=NC2=C(C(=N1)N[C@@H]3C[C@H]3C4=CC(=C(C=C4)F)F)N=NN2[C@@H]5C[C@@H]([C@H]([C@H]5O)O)OCCO |
| Synonyms | AZD 6140 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 99 mg/mL (189.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 52 mg/mL (99.51 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.14 mL | 95.68 mL | 191.35 mL |
| 0.5 mM | 3.83 mL | 19.14 mL | 38.27 mL |
| 1 mM | 1.91 mL | 9.57 mL | 19.14 mL |
| 5 mM | 0.38 mL | 1.91 mL | 3.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
