Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Troglitazone is a selective PPARγ receptor agonist (EC50 values are 780 and 555 nM at murine and human PPARγ receptors respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11981 |
|---|---|
| Formula | C24H27NO5S |
| Molecular Weight | 441.54 |
| CAS Number | 97322-87-7 |
| SMILES | CC1=C(C(=C2CCC(OC2=C1C)(C)COC3=CC=C(C=C3)CC4C(=O)NC(=O)S4)C)O |
| Synonyms | Rezulin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 85 mg/mL (192.51 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 15 mg/mL (33.97 mM) | ||
| In vivo | 1% CMC Na | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.65 mL | 113.24 mL | 226.48 mL |
| 0.5 mM | 4.53 mL | 22.65 mL | 45.3 mL |
| 1 mM | 2.26 mL | 11.32 mL | 22.65 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
