Signaling Pathway
FXR anonist
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tropifexor, also known as LJN452, is a farnesoid X receptor agonist for the Treatment of Cholestatic Liver Diseases and Nonalcoholic Steatohepatitis (NASH). |
|---|
| Catalog Num | A16968 |
|---|---|
| Formula | C29H25F4N3O5S |
| Molecular Weight | 603.58 |
| CAS Number | 1383816-29-2 |
| SMILES | O=C(C1=CC(F)=C2N=C(N3[C@@]4([H])C[C@H](OCC5=C(C6CC6)ON=C5C7=CC=CC=C7OC(F)(F)F)C[C@]3([H])CC4)SC2=C1)O |
| Synonyms | LJN452, LJN-452, LJN 452 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (164.01 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.57 mL | 82.84 mL | 165.68 mL |
| 0.5 mM | 3.31 mL | 16.57 mL | 33.14 mL |
| 1 mM | 1.66 mL | 8.28 mL | 16.57 mL |
| 5 mM | 0.33 mL | 1.66 mL | 3.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
