Loading distributor info...
| Description | Tyrphostin AG-528, also known as Tyrphostin B66, is a EGFR protein tyrosine kinase inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17072 |
|---|---|
| Formula | C18H14N2O3 |
| Molecular Weight | 306.32 |
| CAS Number | 133550-49-9 |
| SMILES | O=C(N1CCC2=C1C=CC=C2)/C(C#N)=C/C3=CC=C(O)C(O)=C3 |
| Synonyms | Tyrphostin B66 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (195.87 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 5 mg/mL (16.32 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.65 mL | 163.23 mL | 326.46 mL |
| 0.5 mM | 6.53 mL | 32.65 mL | 65.29 mL |
| 1 mM | 3.26 mL | 16.32 mL | 32.65 mL |
| 5 mM | 0.65 mL | 3.26 mL | 6.53 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
