Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | U-104 is a novel ureido-sulfonamide inhibitor of Carbonic Anhydrase IX (CAIX). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14959 |
|---|---|
| Formula | C13H12FN3O3S |
| Molecular Weight | 309.32 |
| CAS Number | 178606-66-1 |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)S(=O)(=O)N)F |
| Synonyms | NSC 213841, U 104, U104 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 60 mg/mL (193.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.33 mL | 161.64 mL | 323.29 mL |
| 0.5 mM | 6.47 mL | 32.33 mL | 64.66 mL |
| 1 mM | 3.23 mL | 16.16 mL | 32.33 mL |
| 5 mM | 0.65 mL | 3.23 mL | 6.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
