Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Udenafil is a PDE5 inhibitor used in urology to treat erectile dysfunction. |
|---|
| Catalog Num | A13291 |
|---|---|
| Formula | C25H36N6O3S2 |
| Molecular Weight | 516.66 |
| CAS Number | 268203-93-6 |
| SMILES | O=S(C1=CC=C(OCCC)C(C2=NC3=C(N(C)N=C3CCC)C(N2)=O)=C1)(NCCC4N(C)CCC4)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (189.68 mM) | |
| Water | Insoluble | ||
| Ethanol | 25 mg/mL (48.38 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.36 mL | 96.78 mL | 193.55 mL |
| 0.5 mM | 3.87 mL | 19.36 mL | 38.71 mL |
| 1 mM | 1.94 mL | 9.68 mL | 19.36 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
