Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | UK 5099 is a potent inhibitor of plasma membrane monocarboxylate transporters (MCTs) and the mitochondrial pyruvate carrier (MPC); inhibits pyruvate-dependent O2 consumption with an IC50 of 50 nM. |
|---|
| Catalog Num | A13038 |
|---|---|
| Formula | C18H12N2O2 |
| Molecular Weight | 288.3 |
| CAS Number | 56396-35-1 |
| SMILES | C1=CC=C(C=C1)N2C=C(C3=CC=CC=C32)C=C(C#N)C(=O)O |
| Synonyms | PF-1005023, UK5099, UK-5099, PF1005023, PF 1005023 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (187.3 mM) | |
| Water | Insoluble | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.69 mL | 173.43 mL | 346.86 mL |
| 0.5 mM | 6.94 mL | 34.69 mL | 69.37 mL |
| 1 mM | 3.47 mL | 17.34 mL | 34.69 mL |
| 5 mM | 0.69 mL | 3.47 mL | 6.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
