Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | UNC669 is a small-molecule antagonist of methyl-lysine (KMe) reader protein with selectivity for L3MBTL1 and L3MBTL3 (IC50 of 4.2μM and 3.1μM respectively) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13717 |
|---|---|
| Formula | C15H20BrN3O |
| Molecular Weight | 338.24 |
| CAS Number | 1314241-44-5 |
| SMILES | C1CCN(C1)C2CCN(CC2)C(=O)C3=CC(=CN=C3)Br |
| Synonyms | UNC669, UNC-669 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 10 mg/mL (29.56 mM) | |
| Water | Insoluble | ||
| Ethanol | 62 mg/mL (183.3 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.56 mL | 147.82 mL | 295.65 mL |
| 0.5 mM | 5.91 mL | 29.56 mL | 59.13 mL |
| 1 mM | 2.96 mL | 14.78 mL | 29.56 mL |
| 5 mM | 0.59 mL | 2.96 mL | 5.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
