Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Valemetostat (DS-3201) is a first-in-class EZH1/2 dual inhibitor, used in the research of relapsed/refractory peripheral T-cell lymphoma. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20269 |
|---|---|
| Formula | C26H34ClN3O4 |
| Molecular Weight | 488.02 |
| CAS Number | 1809336-39-7 |
| SMILES | CC1=C(O[C@@](C)([C@]2([H])CC[C@@H](N(C)C)CC2)O3)C3=C(Cl)C=C1C(NCC(C4=O)=C(C=C(C)N4)C)=O |
| Synonyms | DS-3201, DS3201, DS 3201 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (182.36 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.49 mL | 102.45 mL | 204.91 mL |
| 0.5 mM | 4.1 mL | 20.49 mL | 40.98 mL |
| 1 mM | 2.05 mL | 10.25 mL | 20.49 mL |
| 5 mM | 0.41 mL | 2.05 mL | 4.1 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
