Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VGX-1027 displays immunomodulatory and anti-inflammatory activities by inhibiting toll-like receptor 4 (TLR4) signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12548 |
|---|---|
| Formula | C11H11NO3 |
| Molecular Weight | 205.21 |
| CAS Number | 6501-72-0 |
| SMILES | C1C(ON=C1C2=CC=CC=C2)CC(=O)O |
| Synonyms | GIT 27, VGX1027, GIT27 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 38 mg/mL (185.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 38 mg/mL (185.17 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.73 mL | 243.65 mL | 487.31 mL |
| 0.5 mM | 9.75 mL | 48.73 mL | 97.46 mL |
| 1 mM | 4.87 mL | 24.37 mL | 48.73 mL |
| 5 mM | 0.97 mL | 4.87 mL | 9.75 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
