Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Volinanserin is a highly selective 5-HT2A receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17115 |
|---|---|
| Formula | C22H28FNO3 |
| Molecular Weight | 373.46 |
| CAS Number | 139290-65-6 |
| SMILES | O[C@@H](C1=CC=CC(OC)=C1OC)C2CCN(CCC3=CC=C(F)C=C3)CC2 |
| Synonyms | MDL-100907, MDL 100907, MDL100907 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (198.14 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 74 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.78 mL | 133.88 mL | 267.77 mL |
| 0.5 mM | 5.36 mL | 26.78 mL | 53.55 mL |
| 1 mM | 2.68 mL | 13.39 mL | 26.78 mL |
| 5 mM | 0.54 mL | 2.68 mL | 5.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
