Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Voreloxin Hcl is a small molecule and a naphthyridine analogue with antineoplastic activity; inhibitor of Topo II. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15280 |
|---|---|
| Formula | C18H20ClN5O4S |
| Molecular Weight | 437.9 |
| CAS Number | 175519-16-1 |
| SMILES | CNC1CN(CC1OC)C2=NC3=C(C=C2)C(=O)C(=CN3C4=NC=CS4)C(=O)O.Cl |
| Synonyms | SNS-595 Hydrochloride, Vosaroxin Hydrochloride, AG 7352 Hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (2.28 mM) | |
| Water | 1 mg/mL (2.28 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.84 mL | 114.18 mL | 228.36 mL |
| 0.5 mM | 4.57 mL | 22.84 mL | 45.67 mL |
| 1 mM | 2.28 mL | 11.42 mL | 22.84 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
