Loading distributor info...
| Description | Lu-AA21004 is an oral multimodal serotonergic agent, inhibits 5-HT(1A), 5-HT(1B), 5-HT(3A), 5-HT(7) and SERT with IC50 of 15 nM, 33 nM, 3.7 nM, 19 nM and 1.6 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12602 |
|---|---|
| Formula | C18H22N2S.HBr |
| Molecular Weight | 379.36 |
| CAS Number | 960203-27-4 |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=CC=C2N3CCNCC3)C.Br |
| Synonyms | Lu AA21004, LuAA21004, Lu-AA21004 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 68 mg/mL (179.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (39.54 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 6 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.36 mL | 131.8 mL | 263.6 mL |
| 0.5 mM | 5.27 mL | 26.36 mL | 52.72 mL |
| 1 mM | 2.64 mL | 13.18 mL | 26.36 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.27 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
