Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VTX-27 is a selective protein kinase C θ (PKC θ) inhibitor, with Kis of 0.08 nM and 16 nM for PKC θ and PKC δ. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19347 |
|---|---|
| Formula | C20H24ClFN6O |
| Molecular Weight | 418.9 |
| CAS Number | 1321924-70-2 |
| SMILES | FC1=C(N=C(N2C[C@@](NCC2)([H])[C@](C)(O)C(C)C)C(Cl)=C1)C3=NNC4=NC=CC=C34 |
| Synonyms | VTX27, VTX 27 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (181.42 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.87 mL | 119.36 mL | 238.72 mL |
| 0.5 mM | 4.77 mL | 23.87 mL | 47.74 mL |
| 1 mM | 2.39 mL | 11.94 mL | 23.87 mL |
| 5 mM | 0.48 mL | 2.39 mL | 4.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
