Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VU 0357121 is a positive allosteric modulator (PAM) of the metabotropic glutamate receptor 5 (mGlu5) with EC50 = 33 nM, 92% Glumax. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11754 |
|---|---|
| Formula | C17H17F2NO2 |
| Molecular Weight | 305.3 |
| CAS Number | 433967-28-3 |
| SMILES | CCCCOC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)F)F |
| Synonyms | VU0357121,VU-0357121 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (183.41 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL (62.23 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.75 mL | 163.77 mL | 327.55 mL |
| 0.5 mM | 6.55 mL | 32.75 mL | 65.51 mL |
| 1 mM | 3.28 mL | 16.38 mL | 32.75 mL |
| 5 mM | 0.66 mL | 3.28 mL | 6.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
