Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | WDR5-0103 is a small molecule that binds a peptide-binding pocket on WDR5 (Kd = 450 nM), inhibiting the catalytic activity of the MLL core complex in vitro (IC50 = 39 M). |
|---|
| Catalog Num | A15928 |
|---|---|
| Formula | C21H25N3O4 |
| Molecular Weight | 383.45 |
| CAS Number | 890190-22-4 |
| SMILES | O=C(OC)C1=CC(NC(C2=CC=CC(OC)=C2)=O)=C(N3CCN(C)CC3)C=C1 |
| Synonyms | WDR 5-0103, WDR-5-0103 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (177.34 mM) | |
| Water | Insoluble | ||
| Ethanol | 18 mg/mL (46.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.08 mL | 130.4 mL | 260.79 mL |
| 0.5 mM | 5.22 mL | 26.08 mL | 52.16 mL |
| 1 mM | 2.61 mL | 13.04 mL | 26.08 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
