Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | WST-8 is a next generation tetrazolium reagent that serves as a sensitive chromogenic indicator for NADH. |
|---|
| Catalog Num | A15768 |
|---|---|
| Formula | C20H13N6NaO11S2 |
| Molecular Weight | 600.47 |
| CAS Number | 193149-74-5 |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])[N+]2=NC(=NN2C3=CC=C(C=C3)[N+](=O)[O-])C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+] |
| Synonyms | WST 8, WST8 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 3 mg/mL (5 mM) | |
| Water | 87 mg/mL (144.88 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.65 mL | 83.27 mL | 166.54 mL |
| 0.5 mM | 3.33 mL | 16.65 mL | 33.31 mL |
| 1 mM | 1.67 mL | 8.33 mL | 16.65 mL |
| 5 mM | 0.33 mL | 1.67 mL | 3.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
