Signaling Pathway
WYE-687 is a novel ATP-competitive and selective inhibitors of the mammalian target of rapamycin(mTOR).
Important Notice: For research use only. We do not sell to patients.
| Discription | WYE-687 is a novel ATP-competitive and selective inhibitors of the mammalian target of rapamycin(mTOR). |
|||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11187 |
|---|---|
| Formula | C28H32N8O3 |
| Molecular Weight | 528.61 |
| CAS Number | 1062161-90-3 |
| SMILES | COC(=O)NC1=CC=C(C=C1)C2=NC3=C(C=NN3C4CCN(CC4)CC5=CN=CC=C5)C(=N2)N6CCOCC6 |
| Synonyms | WYE687 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 0.45 mg/mL (0.85 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.92 mL | 94.59 mL | 189.18 mL |
| 0.5 mM | 3.78 mL | 18.92 mL | 37.84 mL |
| 1 mM | 1.89 mL | 9.46 mL | 18.92 mL |
| 5 mM | 0.38 mL | 1.89 mL | 3.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
