Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | WZ3146 is an inhibitor of EGFR receptor kinase mutants carrying a mutation in an active site gatekeeper residue (T790M) and is much less potent against wild-type EGFR kinase. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10990 |
|---|---|
| Formula | C24H25ClN6O2 |
| Molecular Weight | 465 |
| CAS Number | 1214265-56-1 |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)OC4=CC=CC(=C4)NC(=O)C=C)Cl |
| Synonyms | WZ-3146 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 83 mg/mL (178.51 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.51 mL | 107.53 mL | 215.05 mL |
| 0.5 mM | 4.3 mL | 21.51 mL | 43.01 mL |
| 1 mM | 2.15 mL | 10.75 mL | 21.51 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
