Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | WZ4002 is EGFR inhibitor against EGFR T790M (mutation of the gatekeeper T790 residue) which is detected in 50% of clinically resistant patients to gefitinib or erlotinib. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A10991 |
|---|---|
| Formula | C25H27ClN6O3 |
| Molecular Weight | 495 |
| CAS Number | 1213269-23-8 |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)OC4=CC=CC(=C4)NC(=O)C=C)Cl)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 12 mg/mL (24.28 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.2 mL | 101.01 mL | 202.02 mL |
| 0.5 mM | 4.04 mL | 20.2 mL | 40.4 mL |
| 1 mM | 2.02 mL | 10.1 mL | 20.2 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
