Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Y06036 is a potent and selective BET inhibitor, which binds to the BRD4(1) bromodomain with Kd value of 82 nM. Antitumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19665 |
|---|---|
| Formula | C16H15BrN2O5S |
| Molecular Weight | 427.27 |
| CAS Number | 1832671-96-1 |
| SMILES | BrC1=CC(S(=O)(NC2=C(OC)C=C(ON=C3C)C3=C2)=O)=C(OC)C=C1 |
| Synonyms | Y-06036; Y 06036 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (180.21 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.4 mL | 117.02 mL | 234.04 mL |
| 0.5 mM | 4.68 mL | 23.4 mL | 46.81 mL |
| 1 mM | 2.34 mL | 11.7 mL | 23.4 mL |
| 5 mM | 0.47 mL | 2.34 mL | 4.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
