Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Y16 is a specific inhibitor of Leukemia-associated Rho guanine nucleotide exchange factor (LARG) with a Kd value of 76 nM. |
|---|
| Catalog Num | A21632 |
|---|---|
| Formula | C24H20N2O3 |
| Molecular Weight | 384.43 |
| CAS Number | 429653-73-6 |
| SMILES | O=C(N1)/C(C(N1C2=CC=CC=C2)=O)=C\C3=CC(OCC4=CC(C)=CC=C4)=CC=C3 |
| Synonyms | Y 16, Y-16 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 34 mg/mL (88.43 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.01 mL | 130.06 mL | 260.13 mL |
| 0.5 mM | 5.2 mL | 26.01 mL | 52.03 mL |
| 1 mM | 2.6 mL | 13.01 mL | 26.01 mL |
| 5 mM | 0.52 mL | 2.6 mL | 5.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
