Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | YKL-06-061 is a potent and selective SIK (salt-inducible kinase) inhibitor. |
|---|
| Catalog Num | A18836 |
|---|---|
| Formula | C30H37N7O2 |
| Molecular Weight | 527.67 |
| CAS Number | 2172617-15-9 |
| SMILES | O=C1N(C2CCC2)C3=NC(NC4=CC=C(N5CCN(C)CC5)C=C4OC)=NC=C3CN1C6=C(C)C=CC=C6C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 18 mg/mL (34.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (7.58 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.95 mL | 94.76 mL | 189.51 mL |
| 0.5 mM | 3.79 mL | 18.95 mL | 37.9 mL |
| 1 mM | 1.9 mL | 9.48 mL | 18.95 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
