Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ZM 336372 is a potent ATP-competitive inhibitor of Raf-1 in vitro (IC50 = 70 nM) with the paradoxical effect of inducing >100-fold activation of Raf-1 in whole cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11077 |
|---|---|
| Formula | C23H23N3O3 |
| Molecular Weight | 389.5 |
| CAS Number | 208260-29-1 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)N(C)C)NC(=O)C3=CC=C(C=C3)O |
| Synonyms | ZM-336372, ZM336372 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (192.58 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.13 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.67 mL | 128.37 mL | 256.74 mL |
| 0.5 mM | 5.13 mL | 25.67 mL | 51.35 mL |
| 1 mM | 2.57 mL | 12.84 mL | 25.67 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
