Loading distributor info...
| Description | Esculetin, a phenolic compound, acts as a 5-LO (5-lipoxygenase, 5-LOX) inhibitor. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A14553 |
|---|---|
| Formula | C9H6O4 |
| Molecular Weight | 178.14 |
| CAS Number | 305-01-1 |
| SMILES | C1=CC(=O)OC2=CC(=C(C=C21)O)O |
| Synonyms | Aesculetin, Cichorigenin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 32 mg/mL (179.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 56.14 mL | 280.68 mL | 561.36 mL |
| 0.5 mM | 11.23 mL | 56.14 mL | 112.27 mL |
| 1 mM | 5.61 mL | 28.07 mL | 56.14 mL |
| 5 mM | 1.12 mL | 5.61 mL | 11.23 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
