Acadesine is a selective activator of AMPK in both hepatocytes and adipocytes.
Loading distributor info...
| Description | Acadesine is a selective activator of AMPK in both hepatocytes and adipocytes. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10028 |
|---|---|
| Formula | C9H14N4O5 |
| Molecular Weight | 258.2 |
| CAS Number | 2627-69-2 |
| SMILES | C1=NC(=C(N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)C(=O)N |
| Synonyms | AICA-riboside |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 44 mg/mL (170.38 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 5 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.73 mL | 193.65 mL | 387.3 mL |
| 0.5 mM | 7.75 mL | 38.73 mL | 77.46 mL |
| 1 mM | 3.87 mL | 19.36 mL | 38.73 mL |
| 5 mM | 0.77 mL | 3.87 mL | 7.75 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
